4-CYANO-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE structure
|
Common Name | 4-CYANO-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 898759-96-1 | Molecular Weight | 279.29000 | |
| Density | 1.29g/cm3 | Boiling Point | 478.6ºC at 760 mmHg | |
| Molecular Formula | C17H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.2ºC | |
| Name | 4-[4-(1,3-dioxolan-2-yl)benzoyl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 478.6ºC at 760 mmHg |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.29000 |
| Flash Point | 208.2ºC |
| Exact Mass | 279.09000 |
| PSA | 59.32000 |
| LogP | 2.83468 |
| Index of Refraction | 1.621 |
| InChIKey | KQLMGDQZPSPFPN-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C(=O)c2ccc(C3OCCO3)cc2)cc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-cyano-4'-(1,3-dioxolan-2-yl)benzophenone |