5-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one structure
|
Common Name | 5-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one | ||
|---|---|---|---|---|
| CAS Number | 89876-09-5 | Molecular Weight | 244.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|
| Molecular Formula | C15H16O3 |
|---|---|
| Molecular Weight | 244.28600 |
| Exact Mass | 244.11000 |
| PSA | 35.53000 |
| LogP | 2.25990 |
| InChIKey | AKHBIBMVORNPEB-UHFFFAOYSA-N |
| SMILES | O=C1CC2C=CC(COCc3ccccc3)(C1)O2 |
|
~89%
5-(phenylmethox... CAS#:89876-09-5 |
| Literature: Rashatasakhon, Paitoon; Harmata, Michael Tetrahedron Letters, 2009 , vol. 50, # 18 p. 2109 - 2110 |
|
~%
5-(phenylmethox... CAS#:89876-09-5 |
| Literature: Noyori; Sato; Kobayashi Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 9 p. 2661 - 2679 |