2-(2,5-DIFLUOROBENZOYL)OXAZOLE
2-(2,5-DIFLUOROBENZOYL)OXAZOLE structure
|
Common Name | 2-(2,5-DIFLUOROBENZOYL)OXAZOLE | ||
|---|---|---|---|---|
| CAS Number | 898760-41-3 | Molecular Weight | 209.14900 | |
| Density | 1.376g/cm3 | Boiling Point | 324.2ºC at 760 mmHg | |
| Molecular Formula | C10H5F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.376g/cm3 |
|---|---|
| Boiling Point | 324.2ºC at 760 mmHg |
| Molecular Formula | C10H5F2NO2 |
| Molecular Weight | 209.14900 |
| Flash Point | 149.9ºC |
| Exact Mass | 209.02900 |
| PSA | 43.10000 |
| LogP | 2.18380 |
| Index of Refraction | 1.522 |
| InChIKey | QHQQYEKFJXLLIA-UHFFFAOYSA-N |
| SMILES | O=C(c1ncco1)c1cc(F)ccc1F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2934999090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(2,5-difluorobenzoyl)oxazole |
| 2,6-dimethyl-3'-(1,3-dioxolan-2-yl)benzophenone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone? |
| A: Polar surface area (PSA) of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone is 43.10000. |
| Q: What is the Chinese name of 898760-41-3? |
| A: Chinese name of 898760-41-3 is 898760-41-3. |
| Q: What is the molecular formula of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone? |
| A: Molecular formula of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone is C10H5F2NO2. |
| Q: What is the SMILES notation of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone? |
| A: SMILES notation of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone is O=C(c1ncco1)c1cc(F)ccc1F. |
| Q: What is the molecular weight of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone? |
| A: Molecular weight of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone is 209.14900. |
| Q: What is the InChIKey of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone? |
| A: InChIKey of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone is QHQQYEKFJXLLIA-UHFFFAOYSA-N. |
| Q: What is the CAS number of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone? |
| A: CAS number of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone is 898760-41-3. |
| Q: What is the boiling point of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone? |
| A: Boiling point of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone is 324.2ºC at 760 mmHg. |
| Q: What is the LogP of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone? |
| A: LogP of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone is 2.18380. |
| Q: What is the English name of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone? |
| A: The English name of (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone is (2,5-difluorophenyl)-(1,3-oxazol-2-yl)methanone. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |