4'-(1,3-DIOXOLAN-2-YL)-3,4,5-TRIFLUOROBENZOPHENONE structure
|
Common Name | 4'-(1,3-DIOXOLAN-2-YL)-3,4,5-TRIFLUOROBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 898760-82-2 | Molecular Weight | 308.25200 | |
| Density | 1.365g/cm3 | Boiling Point | 427.5ºC at 760 mmHg | |
| Molecular Formula | C16H11F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.9ºC | |
| Name | [4-(1,3-dioxolan-2-yl)phenyl]-(3,4,5-trifluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.365g/cm3 |
|---|---|
| Boiling Point | 427.5ºC at 760 mmHg |
| Molecular Formula | C16H11F3O3 |
| Molecular Weight | 308.25200 |
| Flash Point | 204.9ºC |
| Exact Mass | 308.06600 |
| PSA | 35.53000 |
| LogP | 3.38030 |
| Index of Refraction | 1.544 |
| InChIKey | MGFAKKRCJUJNQC-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(C2OCCO2)cc1)c1cc(F)c(F)c(F)c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4'-(1,3-dioxolan-2-yl)-3,4,5-trifluorobenzophenone |