6-CHLORO-1-(3,4-DIFLUOROPHENYL)-1-OXOHEXANE structure
|
Common Name | 6-CHLORO-1-(3,4-DIFLUOROPHENYL)-1-OXOHEXANE | ||
|---|---|---|---|---|
| CAS Number | 898761-54-1 | Molecular Weight | 246.68100 | |
| Density | 1.192g/cm3 | Boiling Point | 339ºC at 760 mmHg | |
| Molecular Formula | C12H13ClF2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.8ºC | |
| Name | 6-chloro-1-(3,4-difluorophenyl)hexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 339ºC at 760 mmHg |
| Molecular Formula | C12H13ClF2O |
| Molecular Weight | 246.68100 |
| Flash Point | 158.8ºC |
| Exact Mass | 246.06200 |
| PSA | 17.07000 |
| LogP | 3.94670 |
| Index of Refraction | 1.488 |
| InChIKey | ZXQNSNXGWUUBRL-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCl)c1ccc(F)c(F)c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 6-chloro-1-(3,4-difluorophenyl)-1-oxohexane |