2-(4-BUTOXYBENZOYL)PYRIDINE structure
|
Common Name | 2-(4-BUTOXYBENZOYL)PYRIDINE | ||
|---|---|---|---|---|
| CAS Number | 898780-03-5 | Molecular Weight | 255.31200 | |
| Density | 1.089g/cm3 | Boiling Point | 403.3ºC at 760 mmHg | |
| Molecular Formula | C16H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.7ºC | |
| Name | (4-butoxyphenyl)-pyridin-2-ylmethanone |
|---|
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 403.3ºC at 760 mmHg |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.31200 |
| Flash Point | 197.7ºC |
| Exact Mass | 255.12600 |
| PSA | 39.19000 |
| LogP | 3.49150 |
| Index of Refraction | 1.55 |
| InChIKey | DULSOECPJZDKAJ-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc(C(=O)c2ccccn2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |