4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)-2'-IODOBUTYROPHENONE structure
|
Common Name | 4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)-2'-IODOBUTYROPHENONE | ||
|---|---|---|---|---|
| CAS Number | 898785-54-1 | Molecular Weight | 388.24100 | |
| Density | 1.391g/cm3 | Boiling Point | 425.2ºC at 760 mmHg | |
| Molecular Formula | C16H21IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.9ºC | |
| Name | 4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(2-iodophenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.391g/cm3 |
|---|---|
| Boiling Point | 425.2ºC at 760 mmHg |
| Molecular Formula | C16H21IO3 |
| Molecular Weight | 388.24100 |
| Flash Point | 210.9ºC |
| Exact Mass | 388.05400 |
| PSA | 35.53000 |
| LogP | 4.04330 |
| Index of Refraction | 1.539 |
| InChIKey | WMLGNMBISXCWPW-UHFFFAOYSA-N |
| SMILES | CC1(C)COC(CCCC(=O)c2ccccc2I)OC1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(5,5-dimethyl-1,3-dioxan-2-yl)-2'-iodobutyrophenone |