4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)-4'-FLUOROBUTYROPHENONE structure
|
Common Name | 4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)-4'-FLUOROBUTYROPHENONE | ||
|---|---|---|---|---|
| CAS Number | 898786-09-9 | Molecular Weight | 280.33500 | |
| Density | 1.073g/cm3 | Boiling Point | 374.4ºC at 760 mmHg | |
| Molecular Formula | C16H21FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.1ºC | |
| Name | 4-(5,5-dimethyl-1,3-dioxan-2-yl)-1-(4-fluorophenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.073g/cm3 |
|---|---|
| Boiling Point | 374.4ºC at 760 mmHg |
| Molecular Formula | C16H21FO3 |
| Molecular Weight | 280.33500 |
| Flash Point | 174.1ºC |
| Exact Mass | 280.14700 |
| PSA | 35.53000 |
| LogP | 3.57780 |
| Index of Refraction | 1.482 |
| InChIKey | PGRNPVZWWUSQLA-UHFFFAOYSA-N |
| SMILES | CC1(C)COC(CCCC(=O)c2ccc(F)cc2)OC1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(5,5-dimethyl-1,3-dioxan-2-yl)-4'-fluorobutyrophenone |