6-CHLORO-1-(2,4-DICHLOROPHENYL)-1-OXOHEXANE structure
|
Common Name | 6-CHLORO-1-(2,4-DICHLOROPHENYL)-1-OXOHEXANE | ||
|---|---|---|---|---|
| CAS Number | 898786-13-5 | Molecular Weight | 279.59000 | |
| Density | 1.257g/cm3 | Boiling Point | 370.4ºC at 760 mmHg | |
| Molecular Formula | C12H13Cl3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.6ºC | |
| Name | 6-chloro-1-(2,4-dichlorophenyl)hexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 370.4ºC at 760 mmHg |
| Molecular Formula | C12H13Cl3O |
| Molecular Weight | 279.59000 |
| Flash Point | 156.6ºC |
| Exact Mass | 278.00300 |
| PSA | 17.07000 |
| LogP | 4.97530 |
| Index of Refraction | 1.537 |
| InChIKey | KTWHGCVIZDTKIA-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCl)c1ccc(Cl)cc1Cl |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 6-chloro-1-(2,4-dichlorophenyl)-1-oxohexane |