3-(1,3-DIOXAN-2-YL)-4'-NITROPROPIOPHENONE structure
|
Common Name | 3-(1,3-DIOXAN-2-YL)-4'-NITROPROPIOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 898786-24-8 | Molecular Weight | 265.26200 | |
| Density | 1.24g/cm3 | Boiling Point | 413.4ºC at 760 mmHg | |
| Molecular Formula | C13H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.6ºC | |
| Name | 3-(1,3-dioxan-2-yl)-1-(4-nitrophenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 413.4ºC at 760 mmHg |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26200 |
| Flash Point | 181.6ºC |
| Exact Mass | 265.09500 |
| PSA | 81.35000 |
| LogP | 2.84390 |
| Index of Refraction | 1.54 |
| InChIKey | BUXYMCQTJRUEAI-UHFFFAOYSA-N |
| SMILES | O=C(CCC1OCCCO1)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(1,3-dioxan-2-yl)-4'-nitropropiophenone |