2',6'-DIFLUORO-4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)BUTYROPHENONE structure
|
Common Name | 2',6'-DIFLUORO-4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)BUTYROPHENONE | ||
|---|---|---|---|---|
| CAS Number | 898786-93-1 | Molecular Weight | 298.32500 | |
| Density | 1.124g/cm3 | Boiling Point | 362.5ºC at 760 mmHg | |
| Molecular Formula | C16H20F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.2ºC | |
| Name | 1-(2,6-difluorophenyl)-4-(5,5-dimethyl-1,3-dioxan-2-yl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.124g/cm3 |
|---|---|
| Boiling Point | 362.5ºC at 760 mmHg |
| Molecular Formula | C16H20F2O3 |
| Molecular Weight | 298.32500 |
| Flash Point | 167.2ºC |
| Exact Mass | 298.13800 |
| PSA | 35.53000 |
| LogP | 3.71690 |
| Index of Refraction | 1.473 |
| InChIKey | LDLPKGYXWSVUAD-UHFFFAOYSA-N |
| SMILES | CC1(C)COC(CCCC(=O)c2c(F)cccc2F)OC1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2',6'-difluoro-4-(5,5-dimethyl-1,3-dioxan-2-yl)butyrophenone |