4-methyl-N-(5-phenyl-1,2,4-thiadiazol-3-yl)benzenesulfonamide structure
|
Common Name | 4-methyl-N-(5-phenyl-1,2,4-thiadiazol-3-yl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 89879-96-9 | Molecular Weight | 331.41300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-N-(5-phenyl-1,2,4-thiadiazol-3-yl)benzenesulfonamide |
|---|
| Molecular Formula | C15H13N3O2S2 |
|---|---|
| Molecular Weight | 331.41300 |
| Exact Mass | 331.04500 |
| PSA | 108.57000 |
| LogP | 4.46810 |
| InChIKey | HPDSEIHULXTEPM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nsc(-c3ccccc3)n2)cc1 |
|
~47%
4-methyl-N-(5-p... CAS#:89879-96-9 |
| Literature: Newton, Christopher G.; Ollis, W. David; Wright, Derek E. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , p. 75 - 84 |