8-(4-ethoxyphenyl)-8-oxooctanoic acid
Modify Date: 2025-09-24 19:05:06
8-(4-ethoxyphenyl)-8-oxooctanoic acid structure
|
Common Name | 8-(4-ethoxyphenyl)-8-oxooctanoic acid | ||
|---|---|---|---|---|
| CAS Number | 898791-71-4 | Molecular Weight | 278.34300 | |
| Density | 1.09g/cm3 | Boiling Point | 464.2ºC at 760 mmHg | |
| Molecular Formula | C16H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.2ºC | |
| Name | 8-(4-ethoxyphenyl)-8-oxooctanoic acid |
|---|
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 464.2ºC at 760 mmHg |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.34300 |
| Flash Point | 168.2ºC |
| Exact Mass | 278.15200 |
| PSA | 63.60000 |
| LogP | 3.69320 |
| Index of Refraction | 1.515 |
| InChIKey | QVAGLYGPTOYQLX-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)CCCCCCC(=O)O)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |