7-(2,4-dimethoxyphenyl)-7-oxoheptanoic acid structure
|
Common Name | 7-(2,4-dimethoxyphenyl)-7-oxoheptanoic acid | ||
|---|---|---|---|---|
| CAS Number | 898792-39-7 | Molecular Weight | 280.31600 | |
| Density | 1.138g/cm3 | Boiling Point | 476.6ºC at 760 mmHg | |
| Molecular Formula | C15H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.5ºC | |
| Name | 7-(2,4-dimethoxyphenyl)-7-oxoheptanoic acid |
|---|
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 476.6ºC at 760 mmHg |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.31600 |
| Flash Point | 175.5ºC |
| Exact Mass | 280.13100 |
| PSA | 72.83000 |
| LogP | 2.92160 |
| Index of Refraction | 1.516 |
| InChIKey | MFHLHDGLOBHRED-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCCCCC(=O)O)c(OC)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |