2,2-dimethyl-5-phenylsulfanyl-6-prop-2-enyl-4,7-dihydro-1,3-dioxepine structure
|
Common Name | 2,2-dimethyl-5-phenylsulfanyl-6-prop-2-enyl-4,7-dihydro-1,3-dioxepine | ||
|---|---|---|---|---|
| CAS Number | 89890-03-9 | Molecular Weight | 276.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-dimethyl-5-phenylsulfanyl-6-prop-2-enyl-4,7-dihydro-1,3-dioxepine |
|---|
| Molecular Formula | C16H20O2S |
|---|---|
| Molecular Weight | 276.39400 |
| Exact Mass | 276.11800 |
| PSA | 43.76000 |
| LogP | 4.39180 |
| InChIKey | WAGABLHXUMTLET-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(Sc2ccccc2)COC(C)(C)OC1 |
|
~99%
2,2-dimethyl-5-... CAS#:89890-03-9 |
| Literature: Hayakawa, Kenji; Kamikawaji, Yoshimasa; Wakita, Akemi; Kanematsu, Ken Journal of Organic Chemistry, 1984 , vol. 49, # 11 p. 1985 - 1989 |
|
~%
2,2-dimethyl-5-... CAS#:89890-03-9 |
| Literature: Hayakawa, Kenji; Kamikawaji, Yoshimasa; Wakita, Akemi; Kanematsu, Ken Journal of Organic Chemistry, 1984 , vol. 49, # 11 p. 1985 - 1989 |