N-methyl-N-trimethylsilylbenzenesulfonamide
N-methyl-N-trimethylsilylbenzenesulfonamide structure
|
Common Name | N-methyl-N-trimethylsilylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 89902-34-1 | Molecular Weight | 243.39800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17NO2SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-methyl-N-trimethylsilylbenzenesulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H17NO2SSi |
|---|---|
| Molecular Weight | 243.39800 |
| Exact Mass | 243.07500 |
| PSA | 45.76000 |
| LogP | 3.22280 |
| InChIKey | HDTNDDJZECDSLZ-UHFFFAOYSA-N |
| SMILES | CN([Si](C)(C)C)S(=O)(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-methyl-N-trim... CAS#:89902-34-1 |
| Literature: Iley, Jim; Bassindale, Alan R.; Patel, Pravin Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 1 p. 77 - 80 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 89902-34-1? |
| A: Chinese name of 89902-34-1 is 89902-34-1. |
| Q: What is the SMILES notation of N-methyl-N-trimethylsilylbenzenesulfonamide? |
| A: SMILES notation of N-methyl-N-trimethylsilylbenzenesulfonamide is CN([Si](C)(C)C)S(=O)(=O)c1ccccc1. |
| Q: What is the LogP of N-methyl-N-trimethylsilylbenzenesulfonamide? |
| A: LogP of N-methyl-N-trimethylsilylbenzenesulfonamide is 3.22280. |
| Q: What is the molecular formula of N-methyl-N-trimethylsilylbenzenesulfonamide? |
| A: Molecular formula of N-methyl-N-trimethylsilylbenzenesulfonamide is C10H17NO2SSi. |
| Q: What is the molecular weight of N-methyl-N-trimethylsilylbenzenesulfonamide? |
| A: Molecular weight of N-methyl-N-trimethylsilylbenzenesulfonamide is 243.39800. |
| Q: What is the InChIKey of N-methyl-N-trimethylsilylbenzenesulfonamide? |
| A: InChIKey of N-methyl-N-trimethylsilylbenzenesulfonamide is HDTNDDJZECDSLZ-UHFFFAOYSA-N. |
| Q: What is the English name of N-methyl-N-trimethylsilylbenzenesulfonamide? |
| A: The English name of N-methyl-N-trimethylsilylbenzenesulfonamide is N-methyl-N-trimethylsilylbenzenesulfonamide. |
| Q: What is the CAS number of N-methyl-N-trimethylsilylbenzenesulfonamide? |
| A: CAS number of N-methyl-N-trimethylsilylbenzenesulfonamide is 89902-34-1. |
| Q: What is the polar surface area (PSA) of N-methyl-N-trimethylsilylbenzenesulfonamide? |
| A: Polar surface area (PSA) of N-methyl-N-trimethylsilylbenzenesulfonamide is 45.76000. |