4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide
4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide structure
|
Common Name | 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 89902-36-3 | Molecular Weight | 319.49400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO2SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H21NO2SSi |
|---|---|
| Molecular Weight | 319.49400 |
| Exact Mass | 319.10600 |
| PSA | 45.76000 |
| LogP | 5.10600 |
| InChIKey | NJVKPHJHFROFPK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(c2ccccc2)[Si](C)(C)C)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-methyl-N-phen... CAS#:89902-36-3 |
| Literature: Iley, Jim; Bassindale, Alan R.; Patel, Pravin Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 1 p. 77 - 80 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide? |
| A: The English name of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide is 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide. |
| Q: What is the SMILES notation of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide? |
| A: SMILES notation of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide is Cc1ccc(S(=O)(=O)N(c2ccccc2)[Si](C)(C)C)cc1. |
| Q: What is the InChIKey of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide? |
| A: InChIKey of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide is NJVKPHJHFROFPK-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide? |
| A: CAS number of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide is 89902-36-3. |
| Q: What is the LogP of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide? |
| A: LogP of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide is 5.10600. |
| Q: What is the polar surface area (PSA) of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide? |
| A: Polar surface area (PSA) of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide is 45.76000. |
| Q: What is the Chinese name of 89902-36-3? |
| A: Chinese name of 89902-36-3 is 89902-36-3. |
| Q: What is the molecular formula of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide? |
| A: Molecular formula of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide is C16H21NO2SSi. |
| Q: What is the molecular weight of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide? |
| A: Molecular weight of 4-methyl-N-phenyl-N-trimethylsilylbenzenesulfonamide is 319.49400. |