trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane
![trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane Structure](https://image.chemsrc.com/caspic/085/89902-44-3.png)
trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane structure
|
Common Name | trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane | ||
|---|---|---|---|---|
| CAS Number | 89902-44-3 | Molecular Weight | 227.39900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17NOSSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H17NOSSi |
|---|---|
| Molecular Weight | 227.39900 |
| Exact Mass | 227.08000 |
| PSA | 37.81000 |
| LogP | 3.84390 |
| InChIKey | QHBOEGRLFRAAJH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N=S(C)(=O)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-trimethylsilyl-S-methyl-S-phenylsulfoximide |
| N-trimethylsilyl-S-methyl-S-phenylsulfoximine |
| S-methyl-N-trimethylsilyl-S-phenylsulfoximine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane? |
| A: Polar surface area (PSA) of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane is 37.81000. |
| Q: What is the InChIKey of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane? |
| A: InChIKey of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane is QHBOEGRLFRAAJH-UHFFFAOYSA-N. |
| Q: What is the LogP of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane? |
| A: LogP of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane is 3.84390. |
| Q: What is the molecular weight of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane? |
| A: Molecular weight of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane is 227.39900. |
| Q: What is the Chinese name of 89902-44-3? |
| A: Chinese name of 89902-44-3 is 89902-44-3. |
| Q: What is the English name of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane? |
| A: The English name of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane is trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane. |
| Q: What English synonyms does trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane have? |
| A: English synonyms of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane: N-trimethylsilyl-S-methyl-S-phenylsulfoximide, N-trimethylsilyl-S-methyl-S-phenylsulfoximine, S-methyl-N-trimethylsilyl-S-phenylsulfoximine. |
| Q: What is the molecular formula of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane? |
| A: Molecular formula of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane is C10H17NOSSi. |
| Q: What is the CAS number of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane? |
| A: CAS number of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane is 89902-44-3. |
| Q: What is the SMILES notation of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane? |
| A: SMILES notation of trimethyl-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]silane is C[Si](C)(C)N=S(C)(=O)c1ccccc1. |