tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid structure
|
Common Name | tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 89902-45-4 | Molecular Weight | 304.47800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24O4SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H24O4SSi |
|---|---|
| Molecular Weight | 304.47800 |
| Exact Mass | 304.11600 |
| PSA | 82.98000 |
| LogP | 4.30640 |
| InChIKey | TUJWDUORIVAMNQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O.Cc1ccc(S(=O)(=O)O)cc1 |
|
~69%
tert-butyl-hydr... CAS#:89902-45-4 |
| Literature: Smith, Jonathan O.; Mandal, Braja K. Journal of Heterocyclic Chemistry, 1997 , vol. 34, # 5 p. 1441 - 1446 |
|
~%
tert-butyl-hydr... CAS#:89902-45-4 |
| Literature: Iley, Jim; Bassindale, Alan R.; Patel, Pravin Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 1 p. 77 - 80 |
| butyldimethylsilyl toluene-4-sulfonate |
| tert-butyldimethylsilyl trifluoromethanesulfonate |