tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid
tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid structure
|
Common Name | tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 89902-45-4 | Molecular Weight | 304.47800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24O4SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H24O4SSi |
|---|---|
| Molecular Weight | 304.47800 |
| Exact Mass | 304.11600 |
| PSA | 82.98000 |
| LogP | 4.30640 |
| InChIKey | TUJWDUORIVAMNQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O.Cc1ccc(S(=O)(=O)O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~69%
tert-butyl-hydr... CAS#:89902-45-4 |
| Literature: Smith, Jonathan O.; Mandal, Braja K. Journal of Heterocyclic Chemistry, 1997 , vol. 34, # 5 p. 1441 - 1446 |
|
~%
tert-butyl-hydr... CAS#:89902-45-4 |
| Literature: Iley, Jim; Bassindale, Alan R.; Patel, Pravin Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 1 p. 77 - 80 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| butyldimethylsilyl toluene-4-sulfonate |
| tert-butyldimethylsilyl trifluoromethanesulfonate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 89902-45-4? |
| A: Chinese name of 89902-45-4 is 89902-45-4. |
| Q: What is the SMILES notation of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid? |
| A: SMILES notation of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid is CC(C)(C)[Si](C)(C)O.Cc1ccc(S(=O)(=O)O)cc1. |
| Q: What is the polar surface area (PSA) of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid? |
| A: Polar surface area (PSA) of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid is 82.98000. |
| Q: What English synonyms does tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid have? |
| A: English synonyms of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid: butyldimethylsilyl toluene-4-sulfonate, tert-butyldimethylsilyl trifluoromethanesulfonate. |
| Q: What is the InChIKey of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid? |
| A: InChIKey of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid is TUJWDUORIVAMNQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid? |
| A: CAS number of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid is 89902-45-4. |
| Q: What is the molecular formula of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid? |
| A: Molecular formula of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid is C13H24O4SSi. |
| Q: What is the molecular weight of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid? |
| A: Molecular weight of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid is 304.47800. |
| Q: What is the English name of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid? |
| A: The English name of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid is tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid. |
| Q: What is the LogP of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid? |
| A: LogP of tert-butyl-hydroxy-dimethylsilane,4-methylbenzenesulfonic acid is 4.30640. |