4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one
4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one structure
|
Common Name | 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one | ||
|---|---|---|---|---|
| CAS Number | 89913-93-9 | Molecular Weight | 290.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H26N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H26N2O5 |
|---|---|
| Molecular Weight | 290.35600 |
| Exact Mass | 290.18400 |
| PSA | 60.47000 |
| InChIKey | MGYQLJGADWUTMC-UHFFFAOYSA-N |
| SMILES | CN1CCOCCOCCOCCOCCN(C)C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~87%
4,6-dimethyl-1,... CAS#:89913-93-9 |
| Literature: Bogat-skii, A. V.; Luk'yanenko, N. G.; Kirichenko, T. I.; Limich, V. V.; Karpenko, L. P. Journal of Organic Chemistry USSR (English Translation), 1984 , vol. 20, # 1 p. 89 - 95 Zhurnal Organicheskoi Khimii, 1984 , vol. 20, # 1 p. 101 - 108 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,9,12,15-Tetraoxa-4,6-diazacycloheptadecan-5-one,4,6-dimethyl |
| 13,15-Dimethyl-1,4,7,10-tetraoxa-13,15-diazacycloheptadecan-14-one |
| 1,3-dimethyl-6,9,12,15-tetraoxa-1,3-diazacycloheptadecan-2-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one? |
| A: CAS number of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one is 89913-93-9. |
| Q: What is the Chinese name of 89913-93-9? |
| A: Chinese name of 89913-93-9 is 89913-93-9. |
| Q: What is the InChIKey of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one? |
| A: InChIKey of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one is MGYQLJGADWUTMC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one? |
| A: SMILES notation of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one is CN1CCOCCOCCOCCOCCN(C)C1=O. |
| Q: What is the molecular weight of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one? |
| A: Molecular weight of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one is 290.35600. |
| Q: What is the polar surface area (PSA) of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one? |
| A: Polar surface area (PSA) of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one is 60.47000. |
| Q: What is the English name of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one? |
| A: The English name of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one is 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one. |
| Q: What is the molecular formula of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one? |
| A: Molecular formula of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one is C13H26N2O5. |
| Q: What English synonyms does 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one have? |
| A: English synonyms of 4,6-dimethyl-1,9,12,15-tetraoxa-4,6-diazacycloheptadecan-5-one: 1,9,12,15-Tetraoxa-4,6-diazacycloheptadecan-5-one,4,6-dimethyl, 13,15-Dimethyl-1,4,7,10-tetraoxa-13,15-diazacycloheptadecan-14-one, 1,3-dimethyl-6,9,12,15-tetraoxa-1,3-diazacycloheptadecan-2-one. |