2-(5-chloro-2-hydroxyphenyl)-9-methoxy-3H-chromeno[2,3-d]pyrimidin-4(5H)-one structure
|
Common Name | 2-(5-chloro-2-hydroxyphenyl)-9-methoxy-3H-chromeno[2,3-d]pyrimidin-4(5H)-one | ||
|---|---|---|---|---|
| CAS Number | 899213-18-4 | Molecular Weight | 356.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H13ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(5-chloro-2-hydroxyphenyl)-9-methoxy-3H-chromeno[2,3-d]pyrimidin-4(5H)-one |
|---|
| Molecular Formula | C18H13ClN2O4 |
|---|---|
| Molecular Weight | 356.8 |
| InChIKey | JIDDEEWUEHOYLO-UHFFFAOYSA-N |
| SMILES | COc1cccc2c1Oc1nc(-c3cc(Cl)ccc3O)[nH]c(=O)c1C2 |
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|