2,4,5-Trichlorophenyl decanoate
Modify Date: 2026-07-18 08:30:28
2,4,5-Trichlorophenyl decanoate structure
|
Common Name | 2,4,5-Trichlorophenyl decanoate | ||
|---|---|---|---|---|
| CAS Number | 89927-90-2 | Molecular Weight | 351.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4,5-Trichlorophenyl decanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H21Cl3O2 |
|---|---|
| Molecular Weight | 351.7 |
| InChIKey | CDAZRCDEDLQYTI-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)Oc1cc(Cl)c(Cl)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,4,5-Trichlorophenyl decanoate? |
| A: The English name of 2,4,5-Trichlorophenyl decanoate is 2,4,5-Trichlorophenyl decanoate. |
| Q: What is the InChIKey of 2,4,5-Trichlorophenyl decanoate? |
| A: InChIKey of 2,4,5-Trichlorophenyl decanoate is CDAZRCDEDLQYTI-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,4,5-Trichlorophenyl decanoate? |
| A: CAS number of 2,4,5-Trichlorophenyl decanoate is 89927-90-2. |
| Q: What is the molecular formula of 2,4,5-Trichlorophenyl decanoate? |
| A: Molecular formula of 2,4,5-Trichlorophenyl decanoate is C16H21Cl3O2. |
| Q: What is the molecular weight of 2,4,5-Trichlorophenyl decanoate? |
| A: Molecular weight of 2,4,5-Trichlorophenyl decanoate is 351.7. |
| Q: What is the Chinese name of 89927-90-2? |
| A: Chinese name of 89927-90-2 is 89927-90-2. |
| Q: What is the SMILES notation of 2,4,5-Trichlorophenyl decanoate? |
| A: SMILES notation of 2,4,5-Trichlorophenyl decanoate is CCCCCCCCCC(=O)Oc1cc(Cl)c(Cl)cc1Cl. |