2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole
Modify Date: 2025-08-29 11:16:49
2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole structure
|
Common Name | 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole | ||
|---|---|---|---|---|
| CAS Number | 899271-50-2 | Molecular Weight | 309.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H6Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H6Cl2N2O3 |
|---|---|
| Molecular Weight | 309.10 |
| InChIKey | YQXKSIFGQLLEEG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2nc(-c3ccc(Cl)c(Cl)c3)oc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole? |
| A: Molecular weight of 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole is 309.10. |
| Q: What is the molecular formula of 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole? |
| A: Molecular formula of 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole is C13H6Cl2N2O3. |
| Q: What is the English name of 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole? |
| A: The English name of 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole is 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole. |
| Q: What is the SMILES notation of 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole? |
| A: SMILES notation of 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole is O=[N+]([O-])c1ccc2nc(-c3ccc(Cl)c(Cl)c3)oc2c1. |
| Q: What is the InChIKey of 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole? |
| A: InChIKey of 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole is YQXKSIFGQLLEEG-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole? |
| A: CAS number of 2-(3,4-Dichlorophenyl)-6-nitro-1,3-benzoxazole is 899271-50-2. |
| Q: What is the Chinese name of 899271-50-2? |
| A: Chinese name of 899271-50-2 is 899271-50-2. |