1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide
Modify Date: 2026-07-28 15:11:25
1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide structure
|
Common Name | 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 899299-75-3 | Molecular Weight | 377.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H15N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H15N3O3S |
|---|---|
| Molecular Weight | 377.4 |
| InChIKey | JXOKRDRSXLENKC-UHFFFAOYSA-N |
| SMILES | O=C(Nc1nccs1)c1ccc2c(c1)C(=O)N(CCc1ccccc1)C2=O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Primary screen in NF54 nanoGlo assay, in single point, at 2uM, 72h
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL4888485
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 899299-75-3? |
| A: Chinese name of 899299-75-3 is 899299-75-3. |
| Q: What is the molecular weight of 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide? |
| A: Molecular weight of 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide is 377.4. |
| Q: What is the SMILES notation of 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide? |
| A: SMILES notation of 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide is O=C(Nc1nccs1)c1ccc2c(c1)C(=O)N(CCc1ccccc1)C2=O. |
| Q: What is the English name of 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide? |
| A: The English name of 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide is 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide. |
| Q: What is the InChIKey of 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide? |
| A: InChIKey of 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide is JXOKRDRSXLENKC-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide? |
| A: CAS number of 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide is 899299-75-3. |
| Q: What is the molecular formula of 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide? |
| A: Molecular formula of 1,3-dioxo-2-(2-phenylethyl)-N-(1,3-thiazol-2-yl)-2,3-dihydro-1H-isoindole-5-carboxamide is C20H15N3O3S. |