Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl structure
|
Common Name | Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl | ||
|---|---|---|---|---|
| CAS Number | 899341-29-8 | Molecular Weight | 520.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H24N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C30H24N4O3S |
|---|---|
| Molecular Weight | 520.6 |
| InChIKey | CMMPNAYAZOTHFE-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)Nc2ccc(SC3CC(=O)N(c4ccc(N=Nc5ccccc5)cc4)C3=O)cc2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 899341-29-8? |
| A: Chinese name of 899341-29-8 is 899341-29-8. |
| Q: What is the SMILES notation of Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl? |
| A: SMILES notation of Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl is Cc1cccc(C(=O)Nc2ccc(SC3CC(=O)N(c4ccc(N=Nc5ccccc5)cc4)C3=O)cc2)c1. |
| Q: What is the CAS number of Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl? |
| A: CAS number of Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl is 899341-29-8. |
| Q: What is the InChIKey of Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl? |
| A: InChIKey of Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl is CMMPNAYAZOTHFE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl? |
| A: Molecular formula of Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl is C30H24N4O3S. |
| Q: What is the English name of Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl? |
| A: The English name of Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl is Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl. |
| Q: What is the molecular weight of Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl? |
| A: Molecular weight of Benzamide, N-[4-[[2,5-dioxo-1-[4-(2-phenyldiazenyl)phenyl]-3-pyrrolidinyl]thio]phenyl]-3-methyl is 520.6. |