(4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone
Modify Date: 2025-09-13 07:42:52
(4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone structure
|
Common Name | (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 899357-77-8 | Molecular Weight | 431.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H21NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H21NO4S |
|---|---|
| Molecular Weight | 431.5 |
| InChIKey | WPDNRCKJJDKZNP-UHFFFAOYSA-N |
| SMILES | COc1ccc2ncc(C(=O)c3ccccc3)c(S(=O)(=O)c3ccc(C)c(C)c3)c2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone? |
| A: InChIKey of (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone is WPDNRCKJJDKZNP-UHFFFAOYSA-N. |
| Q: What is the English name of (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone? |
| A: The English name of (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone is (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone. |
| Q: What is the CAS number of (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone? |
| A: CAS number of (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone is 899357-77-8. |
| Q: What is the molecular weight of (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone? |
| A: Molecular weight of (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone is 431.5. |
| Q: What is the molecular formula of (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone? |
| A: Molecular formula of (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone is C25H21NO4S. |
| Q: What is the Chinese name of 899357-77-8? |
| A: Chinese name of 899357-77-8 is 899357-77-8. |
| Q: What is the SMILES notation of (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone? |
| A: SMILES notation of (4-((3,4-Dimethylphenyl)sulfonyl)-6-methoxyquinolin-3-yl)(phenyl)methanone is COc1ccc2ncc(C(=O)c3ccccc3)c(S(=O)(=O)c3ccc(C)c(C)c3)c2c1. |