1H-IMidazole-4,5-dicarboxylic acid, 2-ethyl-, diethyl ester
1H-IMidazole-4,5-dicarboxylic acid, 2-ethyl-, diethyl ester structure
|
Common Name | 1H-IMidazole-4,5-dicarboxylic acid, 2-ethyl-, diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 89946-68-9 | Molecular Weight | 240.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16N2O4 |
|---|---|
| Molecular Weight | 240.25600 |
| Exact Mass | 240.11100 |
| PSA | 81.28000 |
| LogP | 1.32550 |
| InChIKey | OKGQPGIPGDEGHP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nc(CC)[nH]c1C(=O)OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| diethyl 2-ethylimidazole-4,5-dicarboxylate |
| 1H-Imidazole-4,5-dicarboxylic acid,2-ethyl-,diethyl ester |
| 2-Aethyl-1H-imidazol-4,5-dicarbonsaeure-diaethylester |
| 2-ethyl-1H-imidazole-4,5-dicarboxylic acid diethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 89946-68-9? |
| A: Chinese name of 89946-68-9 is 89946-68-9. |
| Q: What is the InChIKey of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate? |
| A: InChIKey of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate is OKGQPGIPGDEGHP-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate? |
| A: Polar surface area (PSA) of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate is 81.28000. |
| Q: What is the molecular weight of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate? |
| A: Molecular weight of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate is 240.25600. |
| Q: What is the SMILES notation of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate? |
| A: SMILES notation of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate is CCOC(=O)c1nc(CC)[nH]c1C(=O)OCC. |
| Q: What is the LogP of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate? |
| A: LogP of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate is 1.32550. |
| Q: What is the molecular formula of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate? |
| A: Molecular formula of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate is C11H16N2O4. |
| Q: What is the CAS number of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate? |
| A: CAS number of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate is 89946-68-9. |
| Q: What English synonyms does diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate have? |
| A: English synonyms of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate: diethyl 2-ethylimidazole-4,5-dicarboxylate, 1H-Imidazole-4,5-dicarboxylic acid,2-ethyl-,diethyl ester, 2-Aethyl-1H-imidazol-4,5-dicarbonsaeure-diaethylester, 2-ethyl-1H-imidazole-4,5-dicarboxylic acid diethyl ester. |
| Q: What is the English name of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate? |
| A: The English name of diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate is diethyl 2-ethyl-1H-imidazole-4,5-dicarboxylate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |