5-dimethylamino-1,6-dimethyl-3-phenyl-2H-pyrimidin-4-one structure
|
Common Name | 5-dimethylamino-1,6-dimethyl-3-phenyl-2H-pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 89966-56-3 | Molecular Weight | 245.32000 | |
| Density | 1.15g/cm3 | Boiling Point | 334ºC at 760 mmHg | |
| Molecular Formula | C14H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.9ºC | |
| Name | 5-(dimethylamino)-1,6-dimethyl-3-phenyl-2H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 334ºC at 760 mmHg |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.32000 |
| Flash Point | 129.9ºC |
| Exact Mass | 245.15300 |
| PSA | 26.79000 |
| LogP | 1.71850 |
| Index of Refraction | 1.603 |
| InChIKey | DUTHUFHMHDWTIE-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C)C)C(=O)N(c2ccccc2)CN1C |
|
~76%
5-dimethylamino... CAS#:89966-56-3 |
| Literature: Ueda; Sakakibara; Nakagami Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 12 p. 4263 - 4269 |
|
~%
5-dimethylamino... CAS#:89966-56-3 |
| Literature: Ueda; Sakakibara; Nakagami Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 12 p. 4263 - 4269 |
| 1,6-dimethyl-5-dimethylamino-1,2-dihydro-3-phenyl-4(3H)-pyrimidinone |