N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide
Modify Date: 2026-09-28 07:07:21
![N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide Structure](https://www.chemsrc.com/extcaspic/072/899730-46-2.png)
N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide structure
|
Common Name | N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide | ||
|---|---|---|---|---|
| CAS Number | 899730-46-2 | Molecular Weight | 322.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H22N2O5 |
|---|---|
| Molecular Weight | 322.36 |
| InChIKey | UDXMAXODIBGKCX-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccco1)C(=O)NCC1COC2(CCCCC2)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide? |
| A: Molecular formula of N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide is C16H22N2O5. |
| Q: What is the molecular weight of N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide? |
| A: Molecular weight of N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide is 322.36. |
| Q: What is the English name of N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide? |
| A: The English name of N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide is N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide. |
| Q: What is the InChIKey of N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide? |
| A: InChIKey of N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide is UDXMAXODIBGKCX-UHFFFAOYSA-N. |
| Q: What is the CAS number of N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide? |
| A: CAS number of N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide is 899730-46-2. |
| Q: What is the Chinese name of 899730-46-2? |
| A: Chinese name of 899730-46-2 is 899730-46-2. |
| Q: What is the SMILES notation of N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide? |
| A: SMILES notation of N1-(1,4-dioxaspiro[4.5]decan-2-ylmethyl)-N2-(furan-2-ylmethyl)oxalamide is O=C(NCc1ccco1)C(=O)NCC1COC2(CCCCC2)O1. |