5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione structure
|
Common Name | 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione | ||
|---|---|---|---|---|
| CAS Number | 899747-02-5 | Molecular Weight | 277.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15N3O2S |
|---|---|
| Molecular Weight | 277.34 |
| InChIKey | NOQLKZATKADBOG-UHFFFAOYSA-N |
| SMILES | C=CCSc1c(C)cnc2c1c(=O)n(C)c(=O)n2C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione? |
| A: Molecular formula of 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione is C13H15N3O2S. |
| Q: What is the English name of 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione? |
| A: The English name of 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione is 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione. |
| Q: What is the molecular weight of 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione? |
| A: Molecular weight of 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione is 277.34. |
| Q: What is the SMILES notation of 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione? |
| A: SMILES notation of 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione is C=CCSc1c(C)cnc2c1c(=O)n(C)c(=O)n2C. |
| Q: What is the CAS number of 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione? |
| A: CAS number of 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione is 899747-02-5. |
| Q: What is the InChIKey of 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione? |
| A: InChIKey of 5-(allylthio)-1,3,6-trimethylpyrido[2,3-d]pyrimidine-2,4(1H,3H)-dione is NOQLKZATKADBOG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 899747-02-5? |
| A: Chinese name of 899747-02-5 is 899747-02-5. |