3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione
Modify Date: 2026-07-02 10:13:16
![3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione Structure](https://www.chemsrc.com/extcaspic/283/899751-95-2.png)
3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione structure
|
Common Name | 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione | ||
|---|---|---|---|---|
| CAS Number | 899751-95-2 | Molecular Weight | 441.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H14Cl2N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H14Cl2N4O3 |
|---|---|
| Molecular Weight | 441.3 |
| InChIKey | OPSLDXIOSFRWMW-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)n(Cc2ccc(Cl)cc2Cl)c(=O)c2c1nc1oc(-c3ccccc3)cn12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 899751-95-2? |
| A: Chinese name of 899751-95-2 is 899751-95-2. |
| Q: What is the CAS number of 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione? |
| A: CAS number of 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione is 899751-95-2. |
| Q: What is the molecular weight of 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione? |
| A: Molecular weight of 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione is 441.3. |
| Q: What is the SMILES notation of 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione? |
| A: SMILES notation of 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione is Cn1c(=O)n(Cc2ccc(Cl)cc2Cl)c(=O)c2c1nc1oc(-c3ccccc3)cn12. |
| Q: What is the English name of 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione? |
| A: The English name of 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione is 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione. |
| Q: What is the InChIKey of 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione? |
| A: InChIKey of 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione is OPSLDXIOSFRWMW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione? |
| A: Molecular formula of 3-(2,4-dichlorobenzyl)-1-methyl-7-phenyloxazolo[2,3-f]purine-2,4(1H,3H)-dione is C21H14Cl2N4O3. |