N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide
Modify Date: 2025-09-24 21:46:59
N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide structure
|
Common Name | N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 899755-39-6 | Molecular Weight | 429.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H27N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H27N3O4S |
|---|---|
| Molecular Weight | 429.5 |
| InChIKey | ZDDQCPBQNXVEOG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(C(=O)c2ccc(S(=O)(=O)N(C)C)cc2)C(=O)N2CCCCC2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide? |
| A: SMILES notation of N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide is Cc1ccc(N(C(=O)c2ccc(S(=O)(=O)N(C)C)cc2)C(=O)N2CCCCC2)cc1. |
| Q: What is the InChIKey of N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide? |
| A: InChIKey of N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide is ZDDQCPBQNXVEOG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide? |
| A: Molecular formula of N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide is C22H27N3O4S. |
| Q: What is the CAS number of N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide? |
| A: CAS number of N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide is 899755-39-6. |
| Q: What is the Chinese name of 899755-39-6? |
| A: Chinese name of 899755-39-6 is 899755-39-6. |
| Q: What is the English name of N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide? |
| A: The English name of N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide is N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide. |
| Q: What is the molecular weight of N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide? |
| A: Molecular weight of N-(4-(N,N-dimethylsulfamoyl)benzoyl)-N-(p-tolyl)piperidine-1-carboxamide is 429.5. |