N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide
Modify Date: 2026-07-16 20:38:20
N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide structure
|
Common Name | N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 899755-47-6 | Molecular Weight | 378.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17ClF2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H17ClF2N2O2 |
|---|---|
| Molecular Weight | 378.8 |
| InChIKey | GELLAIWFJKRNDZ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)c(F)c1)N(C(=O)N1CCCCC1)c1ccc(Cl)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide? |
| A: Molecular weight of N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide is 378.8. |
| Q: What is the SMILES notation of N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide? |
| A: SMILES notation of N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide is O=C(c1ccc(F)c(F)c1)N(C(=O)N1CCCCC1)c1ccc(Cl)cc1. |
| Q: What is the Chinese name of 899755-47-6? |
| A: Chinese name of 899755-47-6 is 899755-47-6. |
| Q: What is the CAS number of N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide? |
| A: CAS number of N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide is 899755-47-6. |
| Q: What is the molecular formula of N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide? |
| A: Molecular formula of N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide is C19H17ClF2N2O2. |
| Q: What is the English name of N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide? |
| A: The English name of N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide is N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide. |
| Q: What is the InChIKey of N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide? |
| A: InChIKey of N-(4-chlorophenyl)-N-(3,4-difluorobenzoyl)piperidine-1-carboxamide is GELLAIWFJKRNDZ-UHFFFAOYSA-N. |