N-(4-chlorophenyl)-N-(5-nitrofuran-2-carbonyl)piperidine-1-carboxamide structure
|
Common Name | N-(4-chlorophenyl)-N-(5-nitrofuran-2-carbonyl)piperidine-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 899755-53-4 | Molecular Weight | 377.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16ClN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-chlorophenyl)-N-(5-nitrofuran-2-carbonyl)piperidine-1-carboxamide |
|---|
| Molecular Formula | C17H16ClN3O5 |
|---|---|
| Molecular Weight | 377.8 |
| InChIKey | ZGAYYVSYWOYFAC-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc([N+](=O)[O-])o1)N(C(=O)N1CCCCC1)c1ccc(Cl)cc1 |
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|