2-(1,1-dioxido-3-oxobenzo[d]isothiazol-2(3H)-yl)-N-(4-(N-(thiazol-2-yl)sulfamoyl)phenyl)propanamide structure
|
Common Name | 2-(1,1-dioxido-3-oxobenzo[d]isothiazol-2(3H)-yl)-N-(4-(N-(thiazol-2-yl)sulfamoyl)phenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 899758-44-2 | Molecular Weight | 492.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16N4O6S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,1-dioxido-3-oxobenzo[d]isothiazol-2(3H)-yl)-N-(4-(N-(thiazol-2-yl)sulfamoyl)phenyl)propanamide |
|---|
| Molecular Formula | C19H16N4O6S3 |
|---|---|
| Molecular Weight | 492.6 |
| InChIKey | OWIASNNEMSRJRX-UHFFFAOYSA-N |
| SMILES | CC(C(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)N1C(=O)c2ccccc2S1(=O)=O |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|