4-hydroxy-N,N-diphenylpent-2-ynamide
Modify Date: 2025-11-02 17:54:07
4-hydroxy-N,N-diphenylpent-2-ynamide structure
|
Common Name | 4-hydroxy-N,N-diphenylpent-2-ynamide | ||
|---|---|---|---|---|
| CAS Number | 899809-62-2 | Molecular Weight | 265.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-hydroxy-N,N-diphenylpent-2-ynamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H15NO2 |
|---|---|
| Molecular Weight | 265.31 |
| InChIKey | YGFCFRBHEOHPJI-UHFFFAOYSA-N |
| SMILES | CC(O)C#CC(=O)N(c1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-hydroxy-N,N-diphenylpent-2-ynamide? |
| A: SMILES notation of 4-hydroxy-N,N-diphenylpent-2-ynamide is CC(O)C#CC(=O)N(c1ccccc1)c1ccccc1. |
| Q: What is the English name of 4-hydroxy-N,N-diphenylpent-2-ynamide? |
| A: The English name of 4-hydroxy-N,N-diphenylpent-2-ynamide is 4-hydroxy-N,N-diphenylpent-2-ynamide. |
| Q: What is the molecular weight of 4-hydroxy-N,N-diphenylpent-2-ynamide? |
| A: Molecular weight of 4-hydroxy-N,N-diphenylpent-2-ynamide is 265.31. |
| Q: What is the InChIKey of 4-hydroxy-N,N-diphenylpent-2-ynamide? |
| A: InChIKey of 4-hydroxy-N,N-diphenylpent-2-ynamide is YGFCFRBHEOHPJI-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-hydroxy-N,N-diphenylpent-2-ynamide? |
| A: CAS number of 4-hydroxy-N,N-diphenylpent-2-ynamide is 899809-62-2. |
| Q: What is the Chinese name of 899809-62-2? |
| A: Chinese name of 899809-62-2 is 899809-62-2. |
| Q: What is the molecular formula of 4-hydroxy-N,N-diphenylpent-2-ynamide? |
| A: Molecular formula of 4-hydroxy-N,N-diphenylpent-2-ynamide is C17H15NO2. |