bis(trimethylsilyl)methyl-ditert-butylphosphane structure
|
Common Name | bis(trimethylsilyl)methyl-ditert-butylphosphane | ||
|---|---|---|---|---|
| CAS Number | 89982-67-2 | Molecular Weight | 304.59900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H37PSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(trimethylsilyl)methyl-ditert-butylphosphane |
|---|
| Molecular Formula | C15H37PSi2 |
|---|---|
| Molecular Weight | 304.59900 |
| Exact Mass | 304.21700 |
| PSA | 13.59000 |
| LogP | 6.60860 |
| InChIKey | LMGIUMCTTOATMK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(C([Si](C)(C)C)[Si](C)(C)C)C(C)(C)C |
|
~%
bis(trimethylsi... CAS#:89982-67-2 |
| Literature: Neilson, Robert H. Phosphorus and Sulfur and the Related Elements, 1983 , vol. 18, p. 43 - 46 |