N1-(2-(4-chlorophenyl)-5,5-dioxido-4,6-dihydro-2H-thieno[3,4-c]pyrazol-3-yl)-N2-(3-methoxypropyl)oxalamide structure
|
Common Name | N1-(2-(4-chlorophenyl)-5,5-dioxido-4,6-dihydro-2H-thieno[3,4-c]pyrazol-3-yl)-N2-(3-methoxypropyl)oxalamide | ||
|---|---|---|---|---|
| CAS Number | 899962-08-4 | Molecular Weight | 426.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19ClN4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N1-(2-(4-chlorophenyl)-5,5-dioxido-4,6-dihydro-2H-thieno[3,4-c]pyrazol-3-yl)-N2-(3-methoxypropyl)oxalamide |
|---|
| Molecular Formula | C17H19ClN4O5S |
|---|---|
| Molecular Weight | 426.9 |
| InChIKey | RCUSYGXVBAEGEW-UHFFFAOYSA-N |
| SMILES | COCCCNC(=O)C(=O)Nc1c2c(nn1-c1ccc(Cl)cc1)CS(=O)(=O)C2 |
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|