N-{3-cyano-4H,5H,6H-cyclopenta[b]thiophen-2-yl}-4-{[(furan-2-yl)methyl](methyl)sulfamoyl}benzamide
Modify Date: 2025-08-23 17:15:23
![N-{3-cyano-4H,5H,6H-cyclopenta[b]thiophen-2-yl}-4-{[(furan-2-yl)methyl](methyl)sulfamoyl}benzamide Structure](https://www.chemsrc.com/extcaspic/271/899963-87-2.png)
N-{3-cyano-4H,5H,6H-cyclopenta[b]thiophen-2-yl}-4-{[(furan-2-yl)methyl](methyl)sulfamoyl}benzamide structure
|
Common Name | N-{3-cyano-4H,5H,6H-cyclopenta[b]thiophen-2-yl}-4-{[(furan-2-yl)methyl](methyl)sulfamoyl}benzamide | ||
|---|---|---|---|---|
| CAS Number | 899963-87-2 | Molecular Weight | 441.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H19N3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-{3-cyano-4H,5H,6H-cyclopenta[b]thiophen-2-yl}-4-{[(furan-2-yl)methyl](methyl)sulfamoyl}benzamide |
|---|
| Molecular Formula | C21H19N3O4S2 |
|---|---|
| Molecular Weight | 441.5 |
| InChIKey | SKNZLPVIGAJSQO-UHFFFAOYSA-N |
| SMILES | CN(Cc1ccco1)S(=O)(=O)c1ccc(C(=O)Nc2sc3c(c2C#N)CCC3)cc1 |
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
Total 2, Current Page 1 of 1
1