N-(5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl)-4-(N-cyclopentyl-N-methylsulfamoyl)benzamide structure
|
Common Name | N-(5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl)-4-(N-cyclopentyl-N-methylsulfamoyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 899982-75-3 | Molecular Weight | 460.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21ClN4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl)-4-(N-cyclopentyl-N-methylsulfamoyl)benzamide |
|---|
| Molecular Formula | C21H21ClN4O4S |
|---|---|
| Molecular Weight | 460.9 |
| InChIKey | PYTBSKKIUBRBTB-UHFFFAOYSA-N |
| SMILES | CN(C1CCCC1)S(=O)(=O)c1ccc(C(=O)Nc2nnc(-c3ccc(Cl)cc3)o2)cc1 |
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|