2,7-Naphthalenedisulfonicacid, 3-amino-5-hydroxy
Modify Date: 2026-07-19 13:21:50
2,7-Naphthalenedisulfonicacid, 3-amino-5-hydroxy structure
|
Common Name | 2,7-Naphthalenedisulfonicacid, 3-amino-5-hydroxy | ||
|---|---|---|---|---|
| CAS Number | 90-40-4 | Molecular Weight | 319.31100 | |
| Density | 1.88 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-Hydroxy-2-naphthylamine-3,6-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.88 g/cm3 |
|---|---|
| Molecular Formula | C10H9NO7S2 |
| Molecular Weight | 319.31100 |
| Exact Mass | 318.98200 |
| PSA | 171.75000 |
| LogP | 3.36380 |
| InChIKey | VNWVMZDJPMCAKD-UHFFFAOYSA-N |
| SMILES | Nc1cc2c(O)cc(S(=O)(=O)O)cc2cc1S(=O)(=O)O |
| HS Code | 2922299090 |
|---|
|
~%
2,7-Naphthalene... CAS#:90-40-4 |
| Literature: DE53023 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 2, p. 283 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:575-38-2| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| 7-amino-1-naphthol-3,6-disulfonic acid |
| 7-Amino-naphthol-(1)-disulfonsaeure-(3.6) |
| 3-amino-5-hydroxynaphthalene-2,7-disulphonic acid |
| 3-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid |
| 3-azanyl-5-hydroxy-naphthalene-2,7-disulfonic acid |
| 3-Amino-5-hydroxy-naphthalin-2,7-disulfonsaeure |
| 1-hydroxy-7-amino-naphthalene-3,6-disulphonic acid |
| 3-amino-5-hydroxynaphthalene-2,7-disulfonic acid |
| 2-amino-8-naphthol-3,6-disulfonic acid |