N,N-diethylethanamine,2,4,6-trinitrophenol
N,N-diethylethanamine,2,4,6-trinitrophenol structure
|
Common Name | N,N-diethylethanamine,2,4,6-trinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 900-50-5 | Molecular Weight | 330.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N,N-diethylethanamine,2,4,6-trinitrophenol is a chemical substance with Chinese name N,N-二乙基乙基胺-2,4,6-三硝基苯酚, CAS number 900-50-5, molecular formula C12H18N4O7, and molecular weight 330.29400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-diethylethanamine,2,4,6-trinitrophenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H18N4O7 |
|---|---|
| Molecular Weight | 330.29400 |
| Exact Mass | 330.11800 |
| PSA | 160.93000 |
| LogP | 4.03450 |
| InChIKey | SBIAWDQKKCMZRS-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~97%
N,N-diethyletha... CAS#:900-50-5 |
| Literature: Voronkov; Adamovich; Ushakov Russian Journal of General Chemistry, 2014 , vol. 84, # 2 p. 340 - 342 |
|
~%
N,N-diethyletha... CAS#:900-50-5 |
| Literature: Mashkovsky, Alexander A.; Nabiullin, Ahat A.; Odinokov, Stanislav E. Journal of the Chemical Society, Faraday Transactions 1: Physical Chemistry in Condensed Phases, 1987 , vol. 83, p. 1879 - 1884 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Picrinsaeure,Triaethylamin-picrat |
| Triethylamin pikrat |
| Triaethyl-amin,Picrat |
| 2,4,6-trinitro-phenol |
| triethyl-amine,picrate |
| Triethylammonium-pikrat |
| picric acid,triethylamine picrate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N,N-diethylethanamine,2,4,6-trinitrophenol? |
| A: SMILES notation of N,N-diethylethanamine,2,4,6-trinitrophenol is CCN(CC)CC.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1. |
| Q: What is the polar surface area (PSA) of N,N-diethylethanamine,2,4,6-trinitrophenol? |
| A: Polar surface area (PSA) of N,N-diethylethanamine,2,4,6-trinitrophenol is 160.93000. |
| Q: What is the CAS number of N,N-diethylethanamine,2,4,6-trinitrophenol? |
| A: CAS number of N,N-diethylethanamine,2,4,6-trinitrophenol is 900-50-5. |
| Q: What is the Chinese name of 900-50-5? |
| A: Chinese name of 900-50-5 is 900-50-5. |
| Q: What English synonyms does N,N-diethylethanamine,2,4,6-trinitrophenol have? |
| A: English synonyms of N,N-diethylethanamine,2,4,6-trinitrophenol: Picrinsaeure,Triaethylamin-picrat, Triethylamin pikrat, Triaethyl-amin,Picrat, 2,4,6-trinitro-phenol, triethyl-amine,picrate, Triethylammonium-pikrat, picric acid,triethylamine picrate. |
| Q: What is the molecular formula of N,N-diethylethanamine,2,4,6-trinitrophenol? |
| A: Molecular formula of N,N-diethylethanamine,2,4,6-trinitrophenol is C12H18N4O7. |
| Q: What is the English name of N,N-diethylethanamine,2,4,6-trinitrophenol? |
| A: The English name of N,N-diethylethanamine,2,4,6-trinitrophenol is N,N-diethylethanamine,2,4,6-trinitrophenol. |
| Q: What is the LogP of N,N-diethylethanamine,2,4,6-trinitrophenol? |
| A: LogP of N,N-diethylethanamine,2,4,6-trinitrophenol is 4.03450. |
| Q: What is the molecular weight of N,N-diethylethanamine,2,4,6-trinitrophenol? |
| A: Molecular weight of N,N-diethylethanamine,2,4,6-trinitrophenol is 330.29400. |
| Q: What is the InChIKey of N,N-diethylethanamine,2,4,6-trinitrophenol? |
| A: InChIKey of N,N-diethylethanamine,2,4,6-trinitrophenol is SBIAWDQKKCMZRS-UHFFFAOYSA-N. |