1-bis(4-bromophenyl)phosphoryl-4-bromobenzene
1-bis(4-bromophenyl)phosphoryl-4-bromobenzene structure
|
Common Name | 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene | ||
|---|---|---|---|---|
| CAS Number | 900-99-2 | Molecular Weight | 514.97300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12Br3OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-Bis(4-bromophenyl)phosphoryl-4-bromobenzene (CAS: 900-99-2, molecular formula: C18H12Br3OP, molecular weight: 514.97300), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H12Br3OP |
|---|---|
| Molecular Weight | 514.97300 |
| Exact Mass | 511.81800 |
| PSA | 26.88000 |
| LogP | 5.61350 |
| InChIKey | QVKXFHZXOLIUKV-UHFFFAOYSA-N |
| SMILES | O=P(c1ccc(Br)cc1)(c1ccc(Br)cc1)c1ccc(Br)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~87%
1-bis(4-bromoph... CAS#:900-99-2 |
| Literature: Wang, Ying; Ranasinghe, Mahinda I.; Goodson III, Theodore Journal of the American Chemical Society, 2003 , vol. 125, # 32 p. 9562 - 9563 |
|
~29%
1-bis(4-bromoph... CAS#:900-99-2 |
| Literature: Liu, Cui; Li, Yanhu; Li, Yifan; Yang, Chuluo; Wu, Hongbin; Qin, Jingui; Cao, Yong Chemistry of Materials, 2013 , vol. 25, # 16 p. 3320 - 3327 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| T0400-4335 |
| Tris-<4-brom-phenyl>-phosphinoxid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene? |
| A: Molecular formula of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene is C18H12Br3OP. |
| Q: What is the LogP of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene? |
| A: LogP of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene is 5.61350. |
| Q: What is the molecular weight of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene? |
| A: Molecular weight of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene is 514.97300. |
| Q: What English synonyms does 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene have? |
| A: English synonyms of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene: T0400-4335, Tris--phosphinoxid. |
| Q: What is the polar surface area (PSA) of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene? |
| A: Polar surface area (PSA) of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene is 26.88000. |
| Q: What is the English name of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene? |
| A: The English name of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene is 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene. |
| Q: What is the CAS number of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene? |
| A: CAS number of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene is 900-99-2. |
| Q: What is the InChIKey of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene? |
| A: InChIKey of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene is QVKXFHZXOLIUKV-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene? |
| A: SMILES notation of 1-bis(4-bromophenyl)phosphoryl-4-bromobenzene is O=P(c1ccc(Br)cc1)(c1ccc(Br)cc1)c1ccc(Br)cc1. |
| Q: What is the Chinese name of 900-99-2? |
| A: Chinese name of 900-99-2 is 900-99-2. |