2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(aminomethylene)-1,3-dimethyl- structure
|
Common Name | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(aminomethylene)-1,3-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 90000-82-1 | Molecular Weight | 183.16500 | |
| Density | 1.495g/cm3 | Boiling Point | 256.3ºC at 760mmHg | |
| Molecular Formula | C7H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.8ºC | |
| Name | 5-(aminomethylidene)-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.495g/cm3 |
|---|---|
| Boiling Point | 256.3ºC at 760mmHg |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.16500 |
| Flash Point | 108.8ºC |
| Exact Mass | 183.06400 |
| PSA | 83.71000 |
| Index of Refraction | 1.659 |
| InChIKey | PSQJBLXBXDAINV-UHFFFAOYSA-N |
| SMILES | Cn1c(O)c(C=N)c(=O)n(C)c1=O |
|
~%
2,4,6(1H,3H,5H)... CAS#:90000-82-1 |
| Literature: Kreutzberger Arzneimittel Forschung, 1978 , vol. 28, p. 1684,1686 |
|
~%
2,4,6(1H,3H,5H)... CAS#:90000-82-1 |
| Literature: Clark-Lewis; Thompson Journal of the Chemical Society, 1959 , p. 2401,2404 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-Aminomethylen-1,3-dimethyl-barbitursaeure |
| 1,3-Dimethyl-5-aminomethylen-barbitursaeure |
| 5-aminomethylene-1,3-dimethyl-pyrimidine-2,4,6-trione |
| 5-aminomethylene-1,3-dimethyl-barbituric acid |