Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate
Modify Date: 2025-10-19 01:06:34
![Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate Structure](https://www.chemsrc.com/extcaspic/208/900015-01-2.png)
Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate structure
|
Common Name | Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 900015-01-2 | Molecular Weight | 371.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H14FNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H14FNO4S |
|---|---|
| Molecular Weight | 371.4 |
| InChIKey | BAWJEIWNOGEHEB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1sccc1Oc1ccccc1NC(=O)c1ccccc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate? |
| A: Molecular weight of Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate is 371.4. |
| Q: What is the CAS number of Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate? |
| A: CAS number of Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate is 900015-01-2. |
| Q: What is the English name of Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate? |
| A: The English name of Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate is Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate. |
| Q: What is the SMILES notation of Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate? |
| A: SMILES notation of Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate is COC(=O)c1sccc1Oc1ccccc1NC(=O)c1ccccc1F. |
| Q: What is the molecular formula of Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate? |
| A: Molecular formula of Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate is C19H14FNO4S. |
| Q: What is the InChIKey of Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate? |
| A: InChIKey of Methyl 3-{2-[(2-fluorobenzoyl)amino]phenoxy}-2-thiophenecarboxylate is BAWJEIWNOGEHEB-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 900015-01-2? |
| A: Chinese name of 900015-01-2 is 900015-01-2. |