1,2,3,4,5-pentachloro-5-fluorocyclopenta-1,3-diene structure
|
Common Name | 1,2,3,4,5-pentachloro-5-fluorocyclopenta-1,3-diene | ||
|---|---|---|---|---|
| CAS Number | 90013-82-4 | Molecular Weight | 256.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5Cl5F | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3,4,5-pentachloro-5-fluorocyclopenta-1,3-diene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5Cl5F |
|---|---|
| Molecular Weight | 256.31700 |
| Exact Mass | 253.84300 |
| LogP | 4.28300 |
| InChIKey | SJBCPBPWIDSVSS-UHFFFAOYSA-N |
| SMILES | FC1(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl |
|
~10%
1,2,3,4,5-penta... CAS#:90013-82-4 |
| Literature: Paprott, Gerhard; Seppelt, Konrad Journal of the American Chemical Society, 1984 , vol. 106, # 14 p. 4060 - 4061 |
|
~70%
1,2,3,4,5-penta... CAS#:90013-82-4 |
| Literature: Paprott, Gerhard; Lentz, Dieter; Seppelt, Konrad Chemische Berichte, 1984 , vol. 117, # 3 p. 1153 - 1160 |
| 1,2,3,4,5-Pentachlor-5-fluorcyclopentadien |
| 1,3-Cyclopentadiene,1,2,3,4,5-pentachloro-5-fluoro |