Boc-5,5-dimethyl-DL-Pro-OH structure
|
Common Name | Boc-5,5-dimethyl-DL-Pro-OH | ||
|---|---|---|---|---|
| CAS Number | 900158-99-8 | Molecular Weight | 243.299 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 345.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.5±25.9 °C | |
| Name | 5,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 345.1±35.0 °C at 760 mmHg |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.299 |
| Flash Point | 162.5±25.9 °C |
| Exact Mass | 243.147064 |
| PSA | 66.84000 |
| LogP | 1.59 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.484 |
| InChIKey | SFPBDVPSCZYAHV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(C(=O)O)CCC1(C)C |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,5-Dimethyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}proline |
| 1,2-Pyrrolidinedicarboxylic acid, 5,5-dimethyl-, 1-(1,1-dimethylethyl) ester |
| Boc-5,5-dimethyl-DL-Pro-OH |