tert-butyl 3-(4-methylphenyl)-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate structure
|
Common Name | tert-butyl 3-(4-methylphenyl)-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 900503-38-0 | Molecular Weight | 299.40700 | |
| Density | 1.097g/cm3 | Boiling Point | 409.202ºC at 760 mmHg | |
| Molecular Formula | C19H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.278ºC | |
| Name | tert-butyl 3-(4-methylphenyl)-8-azabicyclo[3.2.1]oct-3-ene-8-carboxylate |
|---|
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 409.202ºC at 760 mmHg |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.40700 |
| Flash Point | 201.278ºC |
| Exact Mass | 299.18900 |
| PSA | 29.54000 |
| LogP | 4.48810 |
| Index of Refraction | 1.555 |
| InChIKey | INYGGFZVLKTGSJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2=CC3CCC(C2)N3C(=O)OC(C)(C)C)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |