beta-D-Glucopyranoside, 3,9-dihydroxy-16,17-dimethoxytricyclo(12.3.1.1 (2,6))nonadeca-1(18),2,4,6(19),14,16-hexaen-15-yl, (R)- structure
|
Common Name | beta-D-Glucopyranoside, 3,9-dihydroxy-16,17-dimethoxytricyclo(12.3.1.1 (2,6))nonadeca-1(18),2,4,6(19),14,16-hexaen-15-yl, (R)- | ||
|---|---|---|---|---|
| CAS Number | 90052-02-1 | Molecular Weight | 520.56900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H36O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of beta-D-Glucopyranoside, 3,9-dihydroxy-16,17-dimethoxytricyclo(12.3.1.1 (2,6))nonadeca-1(18),2,4,6(19),14,16-hexaen-15-yl, (R)-5-O-beta-D-Glucopyranosylmyricanol is a diarylheptane compound isolated from Myrica esculenta that has a weak inhibitory effect on angiotensin-converting enzyme (ACE)[1]. |
| Name | Myricanol-15-glucoside |
|---|
| Description | 5-O-beta-D-Glucopyranosylmyricanol is a diarylheptane compound isolated from Myrica esculenta that has a weak inhibitory effect on angiotensin-converting enzyme (ACE)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H36O10 |
|---|---|
| Molecular Weight | 520.56900 |
| Exact Mass | 520.23100 |
| PSA | 158.30000 |
| LogP | 1.27500 |
| InChIKey | NPSYWDNXSMBWKP-LMNFFIPXSA-N |
| SMILES | COc1c2cc(c(OC3OC(CO)C(O)C(O)C3O)c1OC)CCCCC(O)CCc1ccc(O)c-2c1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |