buta-1,3-diene,2-methylprop-2-enoic acid,prop-2-enenitrile structure
|
Common Name | buta-1,3-diene,2-methylprop-2-enoic acid,prop-2-enenitrile | ||
|---|---|---|---|---|
| CAS Number | 9010-81-5 | Molecular Weight | 193.24200 | |
| Density | N/A | Boiling Point | 160.5ºC at 760mmHg | |
| Molecular Formula | C11H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 74.2ºC | |
| Name | buta-1,3-diene,2-methylprop-2-enoic acid,prop-2-enenitrile |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 160.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.24200 |
| Flash Point | 74.2ºC |
| Exact Mass | 193.11000 |
| PSA | 61.09000 |
| LogP | 2.70148 |
| InChIKey | FHTACFVZIAVFCY-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)O.C=CC#N.C=CC=C |
| Methacrylic acid,acrylonitrile,butadiene polymer |
| 1,3-Butadiene,2-propenenitrile,2-methyl-2-propenoic acid polymer |
| 2-Propenoic acid,2-methyl-,polymer with 1,3-butadiene and 2-propenenitrile |
| 1,3-Butadiene,acrylonitrile,methacrylic acid polymer |
| Acrylonitrile,butadiene,methacrylic acid terpolymer |